C12H20N4OS — CID 104584924
4-[2-(1,3-thiazol-2-yl)propylamino]piperidine-1-carboxamide (PubChem CID 104584924) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 4-[2-(1,3-thiazol-2-yl)propylamino]piperidine-1-carboxamide.
| Compound Name | 4-[2-(1,3-thiazol-2-yl)propylamino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 104584924 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-[2-(1,3-thiazol-2-yl)propylamino]piperidine-1-carboxamide |
| SMILES | CC(CNC1CCN(C(N)=O)CC1)c1nccs1 |
| InChI | InChI=1S/C12H20N4OS/c1-9(11-14-4-7-18-11)8-15-10-2-5-16(6-3-10)12(13)17/h4,7,9-10,15H,2-3,5-6,8H2,1H3,(H2,13,17) |
| InChIKey | QPUDPAQCXOGVLJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |