C17H27N3O2S — CID 126818908
tert-butyl 5-(1,3-thiazol-2-ylmethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (PubChem CID 126818908) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is tert-butyl 5-(1,3-thiazol-2-ylmethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-(1,3-thiazol-2-ylmethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 126818908 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | tert-butyl 5-(1,3-thiazol-2-ylmethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(NCc3nccs3)CC2C1 |
| InChI | InChI=1S/C17H27N3O2S/c1-17(2,3)22-16(21)20-10-12-4-5-14(8-13(12)11-20)19-9-15-18-6-7-23-15/h6-7,12-14,19H,4-5,8-11H2,1-3H3 |
| InChIKey | KIWSMRDBJDWIIP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |