C11H15ClN2S — CID 60773865
4-[(6-chloro-3-pyridinyl)methyl]-1,4-thiazepane (PubChem CID 60773865) has the molecular formula C11H15ClN2S and a molecular weight of 242.77 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-1,4-thiazepane.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-1,4-thiazepane |
|---|---|
| PubChem CID | 60773865 |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-1,4-thiazepane |
| SMILES | Clc1ccc(CN2CCCSCC2)cn1 |
| InChI | InChI=1S/C11H15ClN2S/c12-11-3-2-10(8-13-11)9-14-4-1-6-15-7-5-14/h2-3,8H,1,4-7,9H2 |
| InChIKey | APFXWKSKSLCIJQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|