C10H13ClN4 — CID 10176894
1-[(6-chloro-3-pyridinyl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine (PubChem CID 10176894) has the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 10176894 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-5,6-dihydro-4H-pyrimidin-2-amine |
| SMILES | NC1=NCCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H13ClN4/c11-9-3-2-8(6-14-9)7-15-5-1-4-13-10(15)12/h2-3,6H,1,4-5,7H2,(H2,12,13) |
| InChIKey | DBYCTPQLPKSOCZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|