C11H15ClN4O2S — CID 12056540
N-[1-[(6-chloro-3-pyridinyl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]methanesulfonamide (PubChem CID 12056540) has the molecular formula C11H15ClN4O2S and a molecular weight of 302.79 g/mol. Its IUPAC name is N-[1-[(6-chloro-3-pyridinyl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]methanesulfonamide.
| Compound Name | N-[1-[(6-chloro-3-pyridinyl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 12056540 |
| Molecular Formula | C11H15ClN4O2S |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[1-[(6-chloro-3-pyridinyl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1=NCCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H15ClN4O2S/c1-19(17,18)15-11-13-5-2-6-16(11)8-9-3-4-10(12)14-7-9/h3-4,7H,2,5-6,8H2,1H3,(H,13,15) |
| InChIKey | XJUSXADRNVKWGH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|