C12H16ClN3O3S — CID 135365180
[(E)-[1-[(6-chloro-3-pyridinyl)methyl]pyrrolidin-2-ylidene]amino] ethanesulfonate (PubChem CID 135365180) has the molecular formula C12H16ClN3O3S and a molecular weight of 317.80 g/mol. Its IUPAC name is [(E)-[1-[(6-chloro-3-pyridinyl)methyl]pyrrolidin-2-ylidene]amino] ethanesulfonate.
| Compound Name | [(E)-[1-[(6-chloro-3-pyridinyl)methyl]pyrrolidin-2-ylidene]amino] ethanesulfonate |
|---|---|
| PubChem CID | 135365180 |
| Molecular Formula | C12H16ClN3O3S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | [(E)-[1-[(6-chloro-3-pyridinyl)methyl]pyrrolidin-2-ylidene]amino] ethanesulfonate |
| SMILES | CCS(=O)(=O)O/N=C1\CCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H16ClN3O3S/c1-2-20(17,18)19-15-12-4-3-7-16(12)9-10-5-6-11(13)14-8-10/h5-6,8H,2-4,7,9H2,1H3/b15-12+ |
| InChIKey | ZPPCLMNKYYDAAD-NTCAYCPXSA-N |
| XLogP | 2.01 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|