C15H16ClF3N2O — CID 118858174
(3E)-3-[1-[(6-chloro-3-pyridinyl)methyl]azepan-2-ylidene]-1,1,1-trifluoropropan-2-one (PubChem CID 118858174) has the molecular formula C15H16ClF3N2O and a molecular weight of 332.75 g/mol. Its IUPAC name is (3E)-3-[1-[(6-chloro-3-pyridinyl)methyl]azepan-2-ylidene]-1,1,1-trifluoropropan-2-one.
| Compound Name | (3E)-3-[1-[(6-chloro-3-pyridinyl)methyl]azepan-2-ylidene]-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 118858174 |
| Molecular Formula | C15H16ClF3N2O |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (3E)-3-[1-[(6-chloro-3-pyridinyl)methyl]azepan-2-ylidene]-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(/C=C1\CCCCCN1Cc1ccc(Cl)nc1)C(F)(F)F |
| InChI | InChI=1S/C15H16ClF3N2O/c16-14-6-5-11(9-20-14)10-21-7-3-1-2-4-12(21)8-13(22)15(17,18)19/h5-6,8-9H,1-4,7,10H2/b12-8+ |
| InChIKey | SRSJIUCYFKUOGJ-XYOKQWHBSA-N |
| XLogP | 4.13 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|