C11H11ClF3N3O — CID 15030447
(E)-4-[(6-chloro-3-pyridinyl)methylamino]-1,1,1-trifluoro-4-(methylamino)but-3-en-2-one (PubChem CID 15030447) has the molecular formula C11H11ClF3N3O and a molecular weight of 293.68 g/mol. Its IUPAC name is (E)-4-[(6-chloro-3-pyridinyl)methylamino]-1,1,1-trifluoro-4-(methylamino)but-3-en-2-one.
| Compound Name | (E)-4-[(6-chloro-3-pyridinyl)methylamino]-1,1,1-trifluoro-4-(methylamino)but-3-en-2-one |
|---|---|
| PubChem CID | 15030447 |
| Molecular Formula | C11H11ClF3N3O |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (E)-4-[(6-chloro-3-pyridinyl)methylamino]-1,1,1-trifluoro-4-(methylamino)but-3-en-2-one |
| SMILES | CN/C(=C\C(=O)C(F)(F)F)NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H11ClF3N3O/c1-16-10(4-8(19)11(13,14)15)18-6-7-2-3-9(12)17-5-7/h2-5,16,18H,6H2,1H3/b10-4+ |
| InChIKey | JYRJQALCCULNPS-ONNFQVAWSA-N |
| XLogP | 2.02 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|