C12H10ClF3N2OS — CID 14127912
(3Z)-3-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]-1,1,1-trifluoropropan-2-one (PubChem CID 14127912) has the molecular formula C12H10ClF3N2OS and a molecular weight of 322.74 g/mol. Its IUPAC name is (3Z)-3-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]-1,1,1-trifluoropropan-2-one.
| Compound Name | (3Z)-3-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 14127912 |
| Molecular Formula | C12H10ClF3N2OS |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (3Z)-3-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(/C=C1\SCCN1Cc1ccc(Cl)nc1)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF3N2OS/c13-10-2-1-8(6-17-10)7-18-3-4-20-11(18)5-9(19)12(14,15)16/h1-2,5-6H,3-4,7H2/b11-5- |
| InChIKey | YMJBGGDWKVPBMD-WZUFQYTHSA-N |
| XLogP | 3.26 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|