C10H11ClN4OS — CID 86222983
[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]urea (PubChem CID 86222983) has the molecular formula C10H11ClN4OS and a molecular weight of 270.75 g/mol. Its IUPAC name is [3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | [3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 86222983 |
| Molecular Formula | C10H11ClN4OS |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | [3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]urea |
| SMILES | NC(=O)N=C1SCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H11ClN4OS/c11-8-2-1-7(5-13-8)6-15-3-4-17-10(15)14-9(12)16/h1-2,5H,3-4,6H2,(H2,12,16) |
| InChIKey | LEZHOZPJYAQQNU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|