C9H7ClN4O2S — CID 14279649
(NZ)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazol-2-ylidene]nitramide (PubChem CID 14279649) has the molecular formula C9H7ClN4O2S and a molecular weight of 270.70 g/mol. Its IUPAC name is (NZ)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazol-2-ylidene]nitramide.
| Compound Name | (NZ)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazol-2-ylidene]nitramide |
|---|---|
| PubChem CID | 14279649 |
| Molecular Formula | C9H7ClN4O2S |
| Molecular Weight | 270.70 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | (NZ)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazol-2-ylidene]nitramide |
| SMILES | O=[N+]([O-])/N=c1\sccn1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H7ClN4O2S/c10-8-2-1-7(5-11-8)6-13-3-4-17-9(13)12-14(15)16/h1-5H,6H2/b12-9- |
| InChIKey | AOOOIKZSTAKHBL-XFXZXTDPSA-N |
| XLogP | 1.74 |
| TPSA | 73.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.70 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|