C12H11ClF3N3O — CID 14127913
(3E)-3-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-1,1,1-trifluoropropan-2-one (PubChem CID 14127913) has the molecular formula C12H11ClF3N3O and a molecular weight of 305.69 g/mol. Its IUPAC name is (3E)-3-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-1,1,1-trifluoropropan-2-one.
| Compound Name | (3E)-3-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 14127913 |
| Molecular Formula | C12H11ClF3N3O |
| Molecular Weight | 305.69 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (3E)-3-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(/C=C1\NCCN1Cc1ccc(Cl)nc1)C(F)(F)F |
| InChI | InChI=1S/C12H11ClF3N3O/c13-10-2-1-8(6-18-10)7-19-4-3-17-11(19)5-9(20)12(14,15)16/h1-2,5-6,17H,3-4,7H2/b11-5+ |
| InChIKey | UDKXPYYVQQQFBR-VZUCSPMQSA-N |
| XLogP | 2.11 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|