C11H11ClN4 — CID 58496252
(2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]acetonitrile (PubChem CID 58496252) has the molecular formula C11H11ClN4 and a molecular weight of 234.69 g/mol. Its IUPAC name is (2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]acetonitrile.
| Compound Name | (2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 58496252 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]acetonitrile |
| SMILES | N#C/C=C1\NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H11ClN4/c12-10-2-1-9(7-15-10)8-16-6-5-14-11(16)3-4-13/h1-3,7,14H,5-6,8H2/b11-3+ |
| InChIKey | KRDOQTGTCHDIKP-QDEBKDIKSA-N |
| XLogP | 1.51 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|