C10H12ClN4O4PS — CID 174731566
[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide;phosphoric acid (PubChem CID 174731566) has the molecular formula C10H12ClN4O4PS and a molecular weight of 350.72 g/mol. Its IUPAC name is [3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide;phosphoric acid.
| Compound Name | [3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide;phosphoric acid |
|---|---|
| PubChem CID | 174731566 |
| Molecular Formula | C10H12ClN4O4PS |
| Molecular Weight | 350.72 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | [3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide;phosphoric acid |
| SMILES | N#C/N=C1\SCCN1Cc1ccc(Cl)nc1.O=P(O)(O)O |
| InChI | InChI=1S/C10H9ClN4S.H3O4P/c11-9-2-1-8(5-13-9)6-15-3-4-16-10(15)14-7-12;1-5(2,3)4/h1-2,5H,3-4,6H2;(H3,1,2,3,4)/b14-10-; |
| InChIKey | UOYVQUYRQLLDFJ-DZOOLQPHSA-N |
| XLogP | 1.19 |
| TPSA | 130.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.72 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|