C10H12ClN3O2S2 — CID 18414562
(NE)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]methanesulfonamide (PubChem CID 18414562) has the molecular formula C10H12ClN3O2S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is (NE)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]methanesulfonamide.
| Compound Name | (NE)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]methanesulfonamide |
|---|---|
| PubChem CID | 18414562 |
| Molecular Formula | C10H12ClN3O2S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | (NE)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]methanesulfonamide |
| SMILES | CS(=O)(=O)/N=C1/SCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H12ClN3O2S2/c1-18(15,16)13-10-14(4-5-17-10)7-8-2-3-9(11)12-6-8/h2-3,6H,4-5,7H2,1H3/b13-10+ |
| InChIKey | WQGBWUWJPGYCOP-JLHYYAGUSA-N |
| XLogP | 1.60 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|