C10H14ClN5O — CID 142067628
[(E)-[1-[(6-chloro-3-pyridinyl)methyl]-3-methylimidazolidin-2-ylidene]amino]-oxidoazanium (PubChem CID 142067628) has the molecular formula C10H14ClN5O and a molecular weight of 255.71 g/mol. Its IUPAC name is [(E)-[1-[(6-chloro-3-pyridinyl)methyl]-3-methylimidazolidin-2-ylidene]amino]-oxidoazanium.
| Compound Name | [(E)-[1-[(6-chloro-3-pyridinyl)methyl]-3-methylimidazolidin-2-ylidene]amino]-oxidoazanium |
|---|---|
| PubChem CID | 142067628 |
| Molecular Formula | C10H14ClN5O |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | [(E)-[1-[(6-chloro-3-pyridinyl)methyl]-3-methylimidazolidin-2-ylidene]amino]-oxidoazanium |
| SMILES | CN1CCN(Cc2ccc(Cl)nc2)/C1=N/[NH2+][O-] |
| InChI | InChI=1S/C10H14ClN5O/c1-15-4-5-16(10(15)13-14-17)7-8-2-3-9(11)12-6-8/h2-3,6H,4-5,7,14H2,1H3/b13-10+ |
| InChIKey | ZOWBJPRAOFZSBM-JLHYYAGUSA-N |
| XLogP | -0.19 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|