C9H12ClN5O4PS+ — CID 173340395
[[1-[(6-chloro-3-pyridinyl)methyl]-3-dihydroxyphosphinothioylimidazolidin-2-ylidene]amino]-hydroxy-oxoazanium (PubChem CID 173340395) has the molecular formula C9H12ClN5O4PS+ and a molecular weight of 352.72 g/mol. Its IUPAC name is [[1-[(6-chloro-3-pyridinyl)methyl]-3-dihydroxyphosphinothioylimidazolidin-2-ylidene]amino]-hydroxy-oxoazanium.
| Compound Name | [[1-[(6-chloro-3-pyridinyl)methyl]-3-dihydroxyphosphinothioylimidazolidin-2-ylidene]amino]-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 173340395 |
| Molecular Formula | C9H12ClN5O4PS+ |
| Molecular Weight | 352.72 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | [[1-[(6-chloro-3-pyridinyl)methyl]-3-dihydroxyphosphinothioylimidazolidin-2-ylidene]amino]-hydroxy-oxoazanium |
| SMILES | O=[N+](O)N=C1N(Cc2ccc(Cl)nc2)CCN1P(O)(O)=S |
| InChI | InChI=1S/C9H11ClN5O4PS/c10-8-2-1-7(5-11-8)6-13-3-4-14(20(18,19)21)9(13)12-15(16)17/h1-2,5H,3-4,6H2,(H2-,16,17,18,19,21)/p+1 |
| InChIKey | FLEVTJMUTYLZAY-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.72 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|