C12H16ClN5O3 — CID 136598165
(NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;propan-2-one (PubChem CID 136598165) has the molecular formula C12H16ClN5O3 and a molecular weight of 313.75 g/mol. Its IUPAC name is (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;propan-2-one.
| Compound Name | (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;propan-2-one |
|---|---|
| PubChem CID | 136598165 |
| Molecular Formula | C12H16ClN5O3 |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;propan-2-one |
| SMILES | CC(C)=O.O=[N+]([O-])/N=C1\NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H10ClN5O2.C3H6O/c10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17;1-3(2)4/h1-2,5H,3-4,6H2,(H,11,13);1-2H3 |
| InChIKey | NFIXDHLVVBCMNX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|