C20H21Cl2N7O4 — CID 135765294
(NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;3-[(6-chloro-3-pyridinyl)methyl-methylamino]-2H-furan-5-one (PubChem CID 135765294) has the molecular formula C20H21Cl2N7O4 and a molecular weight of 494.34 g/mol. Its IUPAC name is (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;3-[(6-chloro-3-pyridinyl)methyl-methylamino]-2H-furan-5-one.
| Compound Name | (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;3-[(6-chloro-3-pyridinyl)methyl-methylamino]-2H-furan-5-one |
|---|---|
| PubChem CID | 135765294 |
| Molecular Formula | C20H21Cl2N7O4 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;3-[(6-chloro-3-pyridinyl)methyl-methylamino]-2H-furan-5-one |
| SMILES | CN(Cc1ccc(Cl)nc1)C1=CC(=O)OC1.O=[N+]([O-])/N=C1\NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H11ClN2O2.C9H10ClN5O2/c1-14(9-4-11(15)16-7-9)6-8-2-3-10(12)13-5-8;10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h2-5H,6-7H2,1H3;1-2,5H,3-4,6H2,(H,11,13) |
| InChIKey | JKOZORNVQKBUNB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|