C12H10Cl4N4O2 — CID 10293375
2-chloro-5-[[(2Z)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidin-1-yl]methyl]pyridine (PubChem CID 10293375) has the molecular formula C12H10Cl4N4O2 and a molecular weight of 384.05 g/mol. Its IUPAC name is 2-chloro-5-[[(2Z)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidin-1-yl]methyl]pyridine.
| Compound Name | 2-chloro-5-[[(2Z)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 10293375 |
| Molecular Formula | C12H10Cl4N4O2 |
| Molecular Weight | 384.05 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 2-chloro-5-[[(2Z)-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidin-1-yl]methyl]pyridine |
| SMILES | O=[N+]([O-])/C(C(Cl)=C(Cl)Cl)=C1/NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H10Cl4N4O2/c13-8-2-1-7(5-18-8)6-19-4-3-17-12(19)10(20(21)22)9(14)11(15)16/h1-2,5,17H,3-4,6H2/b12-10- |
| InChIKey | BPAVOPNGLGBZLI-BENRWUELSA-N |
| XLogP | 3.47 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.05 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|