C14H17ClN4O2S — CID 173355311
1-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-1-nitropent-4-ene-2-thiol (PubChem CID 173355311) has the molecular formula C14H17ClN4O2S and a molecular weight of 340.84 g/mol. Its IUPAC name is 1-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-1-nitropent-4-ene-2-thiol.
| Compound Name | 1-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-1-nitropent-4-ene-2-thiol |
|---|---|
| PubChem CID | 173355311 |
| Molecular Formula | C14H17ClN4O2S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-1-nitropent-4-ene-2-thiol |
| SMILES | C=CCC(S)C(=C1NCCN1Cc1ccc(Cl)nc1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H17ClN4O2S/c1-2-3-11(22)13(19(20)21)14-16-6-7-18(14)9-10-4-5-12(15)17-8-10/h2,4-5,8,11,16,22H,1,3,6-7,9H2 |
| InChIKey | BVYRRNJKGUOAHP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|