C21H22Cl2N8O5 — CID 159475040
2-chloro-5-[[(2E)-2-(nitromethylidene)imidazolidin-1-yl]methyl]pyridine;(2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-nitroacetaldehyde (PubChem CID 159475040) has the molecular formula C21H22Cl2N8O5 and a molecular weight of 537.36 g/mol. Its IUPAC name is 2-chloro-5-[[(2E)-2-(nitromethylidene)imidazolidin-1-yl]methyl]pyridine;(2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-nitroacetaldehyde.
| Compound Name | 2-chloro-5-[[(2E)-2-(nitromethylidene)imidazolidin-1-yl]methyl]pyridine;(2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-nitroacetaldehyde |
|---|---|
| PubChem CID | 159475040 |
| Molecular Formula | C21H22Cl2N8O5 |
| Molecular Weight | 537.36 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 2-chloro-5-[[(2E)-2-(nitromethylidene)imidazolidin-1-yl]methyl]pyridine;(2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-nitroacetaldehyde |
| SMILES | O=C/C(=C1/NCCN1Cc1ccc(Cl)nc1)[N+](=O)[O-].O=[N+]([O-])/C=C1\NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H11ClN4O3.C10H11ClN4O2/c12-10-2-1-8(5-14-10)6-15-4-3-13-11(15)9(7-17)16(18)19;11-9-2-1-8(5-13-9)6-14-4-3-12-10(14)7-15(16)17/h1-2,5,7,13H,3-4,6H2;1-2,5,7,12H,3-4,6H2/b11-9+;10-7+ |
| InChIKey | LWGTYNNOYJRCQW-CDALOEQFSA-N |
| XLogP | 2.00 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|