C23H25Cl3N6O2 — CID 3507049
1-benzyl-4-[1,1-dichloro-3-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-3-nitroprop-1-en-2-yl]piperazine (PubChem CID 3507049) has the molecular formula C23H25Cl3N6O2 and a molecular weight of 523.85 g/mol. Its IUPAC name is 1-benzyl-4-[1,1-dichloro-3-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-3-nitroprop-1-en-2-yl]piperazine.
| Compound Name | 1-benzyl-4-[1,1-dichloro-3-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-3-nitroprop-1-en-2-yl]piperazine |
|---|---|
| PubChem CID | 3507049 |
| Molecular Formula | C23H25Cl3N6O2 |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 1-benzyl-4-[1,1-dichloro-3-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-3-nitroprop-1-en-2-yl]piperazine |
| SMILES | O=[N+]([O-])C(=C1NCCN1Cc1ccc(Cl)nc1)C(=C(Cl)Cl)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H25Cl3N6O2/c24-19-7-6-18(14-28-19)16-31-9-8-27-23(31)21(32(33)34)20(22(25)26)30-12-10-29(11-13-30)15-17-4-2-1-3-5-17/h1-7,14,27H,8-13,15-16H2 |
| InChIKey | JHZJMYSLALDGHT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 77.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|