C23H24ClN5O — CID 166208623
N-benzyl-4-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]pyridine-2-carboxamide (PubChem CID 166208623) has the molecular formula C23H24ClN5O and a molecular weight of 421.93 g/mol. Its IUPAC name is N-benzyl-4-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-benzyl-4-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166208623 |
| Molecular Formula | C23H24ClN5O |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-benzyl-4-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cc(N2CCN(Cc3ccc(Cl)nc3)CC2)ccn1 |
| InChI | InChI=1S/C23H24ClN5O/c24-22-7-6-19(16-26-22)17-28-10-12-29(13-11-28)20-8-9-25-21(14-20)23(30)27-15-18-4-2-1-3-5-18/h1-9,14,16H,10-13,15,17H2,(H,27,30) |
| InChIKey | QDAJITAYOKZTBR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|