C25H26FN5O2 — CID 133417321
N-benzyl-4-[4-[2-(2-fluoroanilino)-2-oxoethyl]piperazin-1-yl]pyridine-2-carboxamide (PubChem CID 133417321) has the molecular formula C25H26FN5O2 and a molecular weight of 447.51 g/mol. Its IUPAC name is N-benzyl-4-[4-[2-(2-fluoroanilino)-2-oxoethyl]piperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-benzyl-4-[4-[2-(2-fluoroanilino)-2-oxoethyl]piperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 133417321 |
| Molecular Formula | C25H26FN5O2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-benzyl-4-[4-[2-(2-fluoroanilino)-2-oxoethyl]piperazin-1-yl]pyridine-2-carboxamide |
| SMILES | O=C(CN1CCN(c2ccnc(C(=O)NCc3ccccc3)c2)CC1)Nc1ccccc1F |
| InChI | InChI=1S/C25H26FN5O2/c26-21-8-4-5-9-22(21)29-24(32)18-30-12-14-31(15-13-30)20-10-11-27-23(16-20)25(33)28-17-19-6-2-1-3-7-19/h1-11,16H,12-15,17-18H2,(H,28,33)(H,29,32) |
| InChIKey | JZHZGHZYESTVNY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |