C22H24Cl2N8O6 — CID 159107071
(2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-nitroacetaldehyde;(E)-3-[(6-chloro-3-pyridinyl)methyl-methylamino]-3-(methylamino)-2-nitroprop-2-enal (PubChem CID 159107071) has the molecular formula C22H24Cl2N8O6 and a molecular weight of 567.39 g/mol. Its IUPAC name is (2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-nitroacetaldehyde;(E)-3-[(6-chloro-3-pyridinyl)methyl-methylamino]-3-(methylamino)-2-nitroprop-2-enal.
| Compound Name | (2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-nitroacetaldehyde;(E)-3-[(6-chloro-3-pyridinyl)methyl-methylamino]-3-(methylamino)-2-nitroprop-2-enal |
|---|---|
| PubChem CID | 159107071 |
| Molecular Formula | C22H24Cl2N8O6 |
| Molecular Weight | 567.39 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | (2E)-2-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-nitroacetaldehyde;(E)-3-[(6-chloro-3-pyridinyl)methyl-methylamino]-3-(methylamino)-2-nitroprop-2-enal |
| SMILES | CN/C(=C(/C=O)[N+](=O)[O-])N(C)Cc1ccc(Cl)nc1.O=C/C(=C1/NCCN1Cc1ccc(Cl)nc1)[N+](=O)[O-] |
| InChI | InChI=1S/C11H11ClN4O3.C11H13ClN4O3/c12-10-2-1-8(5-14-10)6-15-4-3-13-11(15)9(7-17)16(18)19;1-13-11(9(7-17)16(18)19)15(2)6-8-3-4-10(12)14-5-8/h1-2,5,7,13H,3-4,6H2;3-5,7,13H,6H2,1-2H3/b2*11-9+ |
| InChIKey | KEAFAJYTPIWBLL-YBLOMHCGSA-N |
| XLogP | 1.82 |
| TPSA | 176.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|