C10H11ClN4O4 — CID 142916470
(E)-3-[(6-chloro-3-pyridinyl)methyl-hydroxyamino]-3-(methylamino)-2-nitroprop-2-enal (PubChem CID 142916470) has the molecular formula C10H11ClN4O4 and a molecular weight of 286.68 g/mol. Its IUPAC name is (E)-3-[(6-chloro-3-pyridinyl)methyl-hydroxyamino]-3-(methylamino)-2-nitroprop-2-enal.
| Compound Name | (E)-3-[(6-chloro-3-pyridinyl)methyl-hydroxyamino]-3-(methylamino)-2-nitroprop-2-enal |
|---|---|
| PubChem CID | 142916470 |
| Molecular Formula | C10H11ClN4O4 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (E)-3-[(6-chloro-3-pyridinyl)methyl-hydroxyamino]-3-(methylamino)-2-nitroprop-2-enal |
| SMILES | CN/C(=C(/C=O)[N+](=O)[O-])N(O)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H11ClN4O4/c1-12-10(8(6-16)15(18)19)14(17)5-7-2-3-9(11)13-4-7/h2-4,6,12,17H,5H2,1H3/b10-8+ |
| InChIKey | LOXCCLLPURQJNE-CSKARUKUSA-N |
| XLogP | 0.79 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|