C20H22Cl2N8O6 — CID 157130346
N-[(Z)-1-[(6-chloro-3-pyridinyl)methylamino]-2-nitroethenyl]-N-methylformamide;N-[(6-chloro-3-pyridinyl)methyl]-N-[(Z)-1-(methylamino)-2-nitroethenyl]formamide (PubChem CID 157130346) has the molecular formula C20H22Cl2N8O6 and a molecular weight of 541.35 g/mol. Its IUPAC name is N-[(Z)-1-[(6-chloro-3-pyridinyl)methylamino]-2-nitroethenyl]-N-methylformamide;N-[(6-chloro-3-pyridinyl)methyl]-N-[(Z)-1-(methylamino)-2-nitroethenyl]formamide.
| Compound Name | N-[(Z)-1-[(6-chloro-3-pyridinyl)methylamino]-2-nitroethenyl]-N-methylformamide;N-[(6-chloro-3-pyridinyl)methyl]-N-[(Z)-1-(methylamino)-2-nitroethenyl]formamide |
|---|---|
| PubChem CID | 157130346 |
| Molecular Formula | C20H22Cl2N8O6 |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | N-[(Z)-1-[(6-chloro-3-pyridinyl)methylamino]-2-nitroethenyl]-N-methylformamide;N-[(6-chloro-3-pyridinyl)methyl]-N-[(Z)-1-(methylamino)-2-nitroethenyl]formamide |
| SMILES | CN(C=O)/C(=C\[N+](=O)[O-])NCc1ccc(Cl)nc1.CN/C(=C/[N+](=O)[O-])N(C=O)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/2C10H11ClN4O3/c1-14(7-16)10(6-15(17)18)13-5-8-2-3-9(11)12-4-8;1-12-10(6-15(17)18)14(7-16)5-8-2-3-9(11)13-4-8/h2-4,6-7,13H,5H2,1H3;2-4,6-7,12H,5H2,1H3/b2*10-6- |
| InChIKey | AIZMZBFBEPUYEI-VRGQSPJESA-N |
| XLogP | 1.98 |
| TPSA | 176.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|