C10H11BrN4O3 — CID 18649374
N-[(6-bromo-3-pyridinyl)methyl]-N-[(E)-1-(methylamino)-2-nitroethenyl]formamide (PubChem CID 18649374) has the molecular formula C10H11BrN4O3 and a molecular weight of 315.13 g/mol. Its IUPAC name is N-[(6-bromo-3-pyridinyl)methyl]-N-[(E)-1-(methylamino)-2-nitroethenyl]formamide.
| Compound Name | N-[(6-bromo-3-pyridinyl)methyl]-N-[(E)-1-(methylamino)-2-nitroethenyl]formamide |
|---|---|
| PubChem CID | 18649374 |
| Molecular Formula | C10H11BrN4O3 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | N-[(6-bromo-3-pyridinyl)methyl]-N-[(E)-1-(methylamino)-2-nitroethenyl]formamide |
| SMILES | CN/C(=C\[N+](=O)[O-])N(C=O)Cc1ccc(Br)nc1 |
| InChI | InChI=1S/C10H11BrN4O3/c1-12-10(6-15(17)18)14(7-16)5-8-2-3-9(11)13-4-8/h2-4,6-7,12H,5H2,1H3/b10-6+ |
| InChIKey | BHIIUKDGVIJFDC-UXBLZVDNSA-N |
| XLogP | 1.10 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|