C11H16N4O3 — CID 22450522
(Z)-1-N'-[(6-methoxy-3-pyridinyl)methyl]-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine (PubChem CID 22450522) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is (Z)-1-N'-[(6-methoxy-3-pyridinyl)methyl]-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine.
| Compound Name | (Z)-1-N'-[(6-methoxy-3-pyridinyl)methyl]-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 22450522 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (Z)-1-N'-[(6-methoxy-3-pyridinyl)methyl]-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine |
| SMILES | CN/C(=C/[N+](=O)[O-])N(C)Cc1ccc(OC)nc1 |
| InChI | InChI=1S/C11H16N4O3/c1-12-10(8-15(16)17)14(2)7-9-4-5-11(18-3)13-6-9/h4-6,8,12H,7H2,1-3H3/b10-8- |
| InChIKey | PJJNCJAHNZDJSZ-NTMALXAHSA-N |
| XLogP | 0.82 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|