C16H27ClN5O6PS — CID 87446492
(E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine;2-dimethoxyphosphorylsulfanyl-N-methylacetamide (PubChem CID 87446492) has the molecular formula C16H27ClN5O6PS and a molecular weight of 483.92 g/mol. Its IUPAC name is (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine;2-dimethoxyphosphorylsulfanyl-N-methylacetamide.
| Compound Name | (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine;2-dimethoxyphosphorylsulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 87446492 |
| Molecular Formula | C16H27ClN5O6PS |
| Molecular Weight | 483.92 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine;2-dimethoxyphosphorylsulfanyl-N-methylacetamide |
| SMILES | CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC.CNC(=O)CSP(=O)(OC)OC |
| InChI | InChI=1S/C11H15ClN4O2.C5H12NO4PS/c1-3-15(11(13-2)8-16(17)18)7-9-4-5-10(12)14-6-9;1-6-5(7)4-12-11(8,9-2)10-3/h4-6,8,13H,3,7H2,1-2H3;4H2,1-3H3,(H,6,7)/b11-8+; |
| InChIKey | FDEIFXHOQLTQQY-YGCVIUNWSA-N |
| XLogP | 2.72 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.92 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|