C25H30ClN7O2 — CID 88537316
(E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine;4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine (PubChem CID 88537316) has the molecular formula C25H30ClN7O2 and a molecular weight of 496.02 g/mol. Its IUPAC name is (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine;4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine.
| Compound Name | (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine;4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 88537316 |
| Molecular Formula | C25H30ClN7O2 |
| Molecular Weight | 496.02 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine;4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine |
| SMILES | CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC.Cc1cc(C2CC2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H15N3.C11H15ClN4O2/c1-10-9-13(11-7-8-11)17-14(15-10)16-12-5-3-2-4-6-12;1-3-15(11(13-2)8-16(17)18)7-9-4-5-10(12)14-6-9/h2-6,9,11H,7-8H2,1H3,(H,15,16,17);4-6,8,13H,3,7H2,1-2H3/b;11-8+ |
| InChIKey | DUHJGSSKEPFBNU-IBMQDACXSA-N |
| XLogP | 5.26 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.02 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|