C12H16ClN5O2 — CID 54359798
N'-[1-[(6-chloro-3-pyridinyl)methyl-methylamino]-2-nitroethenyl]-N,N-dimethylmethanimidamide (PubChem CID 54359798) has the molecular formula C12H16ClN5O2 and a molecular weight of 297.75 g/mol. Its IUPAC name is N'-[1-[(6-chloro-3-pyridinyl)methyl-methylamino]-2-nitroethenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(6-chloro-3-pyridinyl)methyl-methylamino]-2-nitroethenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 54359798 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N'-[1-[(6-chloro-3-pyridinyl)methyl-methylamino]-2-nitroethenyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=NC(=C[N+](=O)[O-])N(C)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H16ClN5O2/c1-16(2)9-15-12(8-18(19)20)17(3)7-10-4-5-11(13)14-6-10/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | ULSCGYCUBBCKFV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|