C13H19ClN4O2S — CID 21274568
N'-[(6-chloro-3-pyridinyl)methyl]-N-[(E)-1-ethylsulfanyl-2-nitroethenyl]-N'-methylethane-1,2-diamine (PubChem CID 21274568) has the molecular formula C13H19ClN4O2S and a molecular weight of 330.84 g/mol. Its IUPAC name is N'-[(6-chloro-3-pyridinyl)methyl]-N-[(E)-1-ethylsulfanyl-2-nitroethenyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[(6-chloro-3-pyridinyl)methyl]-N-[(E)-1-ethylsulfanyl-2-nitroethenyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 21274568 |
| Molecular Formula | C13H19ClN4O2S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N'-[(6-chloro-3-pyridinyl)methyl]-N-[(E)-1-ethylsulfanyl-2-nitroethenyl]-N'-methylethane-1,2-diamine |
| SMILES | CCS/C(=C/[N+](=O)[O-])NCCN(C)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H19ClN4O2S/c1-3-21-13(10-18(19)20)15-6-7-17(2)9-11-4-5-12(14)16-8-11/h4-5,8,10,15H,3,6-7,9H2,1-2H3/b13-10+ |
| InChIKey | SUYMTALWQFTENB-JLHYYAGUSA-N |
| XLogP | 2.59 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|