C10H12ClN5O4 — CID 15477293
methyl N-[[(E)-1-[(6-chloro-3-pyridinyl)methylamino]-2-nitroethenyl]amino]carbamate (PubChem CID 15477293) has the molecular formula C10H12ClN5O4 and a molecular weight of 301.69 g/mol. Its IUPAC name is methyl N-[[(E)-1-[(6-chloro-3-pyridinyl)methylamino]-2-nitroethenyl]amino]carbamate.
| Compound Name | methyl N-[[(E)-1-[(6-chloro-3-pyridinyl)methylamino]-2-nitroethenyl]amino]carbamate |
|---|---|
| PubChem CID | 15477293 |
| Molecular Formula | C10H12ClN5O4 |
| Molecular Weight | 301.69 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | methyl N-[[(E)-1-[(6-chloro-3-pyridinyl)methylamino]-2-nitroethenyl]amino]carbamate |
| SMILES | COC(=O)NN/C(=C/[N+](=O)[O-])NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H12ClN5O4/c1-20-10(17)15-14-9(6-16(18)19)13-5-7-2-3-8(11)12-4-7/h2-4,6,13-14H,5H2,1H3,(H,15,17)/b9-6+ |
| InChIKey | XJKYHEALPQSMRM-RMKNXTFCSA-N |
| XLogP | 0.76 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.69 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|