C8H10ClIN5O3- — CID 172949655
1-[(6-chloro-3-pyridinyl)methyl]-3-methoxy-2-nitroguanidine iodide (PubChem CID 172949655) has the molecular formula C8H10ClIN5O3- and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3-methoxy-2-nitroguanidine iodide.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-methoxy-2-nitroguanidine iodide |
|---|---|
| PubChem CID | 172949655 |
| Molecular Formula | C8H10ClIN5O3- |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-methoxy-2-nitroguanidine iodide |
| SMILES | CON/C(=N\[N+](=O)[O-])NCc1ccc(Cl)nc1.[I-] |
| InChI | InChI=1S/C8H10ClN5O3.HI/c1-17-13-8(12-14(15)16)11-5-6-2-3-7(9)10-4-6;/h2-4H,5H2,1H3,(H2,11,12,13);1H/p-1 |
| InChIKey | WMEROOVZJOCFCG-UHFFFAOYSA-M |
| XLogP | -2.47 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|