C8H10ClN5O2 — CID 135537100
1-[(6-chloro-3-pyridinyl)methyl]-3-methyl-2-nitroguanidine (PubChem CID 135537100) has the molecular formula C8H10ClN5O2 and a molecular weight of 243.65 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3-methyl-2-nitroguanidine.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-methyl-2-nitroguanidine |
|---|---|
| PubChem CID | 135537100 |
| Molecular Formula | C8H10ClN5O2 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-methyl-2-nitroguanidine |
| SMILES | CN/C(=N\[N+](=O)[O-])NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C8H10ClN5O2/c1-10-8(13-14(15)16)12-5-6-2-3-7(9)11-4-6/h2-4H,5H2,1H3,(H2,10,12,13) |
| InChIKey | SWHRDLPFZQFSLS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|