C5H8ClN7O2 — CID 142628325
1-[(2-chlorotriazol-4-yl)methyl]-3-methyl-2-nitroguanidine (PubChem CID 142628325) has the molecular formula C5H8ClN7O2 and a molecular weight of 233.62 g/mol. Its IUPAC name is 1-[(2-chlorotriazol-4-yl)methyl]-3-methyl-2-nitroguanidine.
| Compound Name | 1-[(2-chlorotriazol-4-yl)methyl]-3-methyl-2-nitroguanidine |
|---|---|
| PubChem CID | 142628325 |
| Molecular Formula | C5H8ClN7O2 |
| Molecular Weight | 233.62 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 1-[(2-chlorotriazol-4-yl)methyl]-3-methyl-2-nitroguanidine |
| SMILES | CNC(=N[N+](=O)[O-])NCc1cnn(Cl)n1 |
| InChI | InChI=1S/C5H8ClN7O2/c1-7-5(11-13(14)15)8-2-4-3-9-12(6)10-4/h3H,2H2,1H3,(H2,7,8,11) |
| InChIKey | IFQDNBBIEIJARB-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.62 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|