C7H12ClN7O3S — CID 137222702
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;urea (PubChem CID 137222702) has the molecular formula C7H12ClN7O3S and a molecular weight of 309.74 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;urea.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;urea |
|---|---|
| PubChem CID | 137222702 |
| Molecular Formula | C7H12ClN7O3S |
| Molecular Weight | 309.74 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;urea |
| SMILES | CN/C(=N\[N+](=O)[O-])NCc1cnc(Cl)s1.NC(N)=O |
| InChI | InChI=1S/C6H8ClN5O2S.CH4N2O/c1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4;2-1(3)4/h2H,3H2,1H3,(H2,8,10,11);(H4,2,3,4) |
| InChIKey | VAIIYAXKEVZNFX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 161.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.74 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|