C25H31ClN6O5S — CID 135862994
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-methoxy-N-methylacetamide (PubChem CID 135862994) has the molecular formula C25H31ClN6O5S and a molecular weight of 563.08 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-methoxy-N-methylacetamide.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 135862994 |
| Molecular Formula | C25H31ClN6O5S |
| Molecular Weight | 563.08 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-methoxy-N-methylacetamide |
| SMILES | CN/C(=N\[N+](=O)[O-])NCc1cnc(Cl)s1.CNC(=O)C(OC)c1ccccc1COc1cc(C)ccc1C |
| InChI | InChI=1S/C19H23NO3.C6H8ClN5O2S/c1-13-9-10-14(2)17(11-13)23-12-15-7-5-6-8-16(15)18(22-4)19(21)20-3;1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4/h5-11,18H,12H2,1-4H3,(H,20,21);2H,3H2,1H3,(H2,8,10,11) |
| InChIKey | RFPQAYQJJFXQEZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 140.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.08 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|