C17H17NO5 — CID 139703544
2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-nitroacetic acid (PubChem CID 139703544) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-nitroacetic acid.
| Compound Name | 2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-nitroacetic acid |
|---|---|
| PubChem CID | 139703544 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-nitroacetic acid |
| SMILES | Cc1ccc(C)c(OCc2ccccc2C(C(=O)O)[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17NO5/c1-11-7-8-12(2)15(9-11)23-10-13-5-3-4-6-14(13)16(17(19)20)18(21)22/h3-9,16H,10H2,1-2H3,(H,19,20) |
| InChIKey | WVNQTBSSQKTTNI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|