C17H17ClO3 — CID 139703547
2-chloro-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]acetic acid (PubChem CID 139703547) has the molecular formula C17H17ClO3 and a molecular weight of 304.77 g/mol. Its IUPAC name is 2-chloro-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]acetic acid.
| Compound Name | 2-chloro-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 139703547 |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-chloro-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]acetic acid |
| SMILES | Cc1ccc(C)c(OCc2ccccc2C(Cl)C(=O)O)c1 |
| InChI | InChI=1S/C17H17ClO3/c1-11-7-8-12(2)15(9-11)21-10-13-5-3-4-6-14(13)16(18)17(19)20/h3-9,16H,10H2,1-2H3,(H,19,20) |
| InChIKey | DCJHNQBNAZQKEO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|