C10H18ClN6O5PS2 — CID 135540769
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;N-[methoxy(methylsulfanyl)phosphoryl]acetamide (PubChem CID 135540769) has the molecular formula C10H18ClN6O5PS2 and a molecular weight of 432.85 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;N-[methoxy(methylsulfanyl)phosphoryl]acetamide.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;N-[methoxy(methylsulfanyl)phosphoryl]acetamide |
|---|---|
| PubChem CID | 135540769 |
| Molecular Formula | C10H18ClN6O5PS2 |
| Molecular Weight | 432.85 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;N-[methoxy(methylsulfanyl)phosphoryl]acetamide |
| SMILES | CN/C(=N\[N+](=O)[O-])NCc1cnc(Cl)s1.COP(=O)(NC(C)=O)SC |
| InChI | InChI=1S/C6H8ClN5O2S.C4H10NO3PS/c1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4;1-4(6)5-9(7,8-2)10-3/h2H,3H2,1H3,(H2,8,10,11);1-3H3,(H,5,6,7) |
| InChIKey | UHTSQQUAEJCKAB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 147.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.85 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|