C24H31ClF2N8O3S — CID 135900244
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;3-(difluoromethyl)-N-[2-(3,3-dimethylbutyl)phenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 135900244) has the molecular formula C24H31ClF2N8O3S and a molecular weight of 585.08 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;3-(difluoromethyl)-N-[2-(3,3-dimethylbutyl)phenyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;3-(difluoromethyl)-N-[2-(3,3-dimethylbutyl)phenyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 135900244 |
| Molecular Formula | C24H31ClF2N8O3S |
| Molecular Weight | 585.08 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;3-(difluoromethyl)-N-[2-(3,3-dimethylbutyl)phenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | CN/C(=N\[N+](=O)[O-])NCc1cnc(Cl)s1.Cn1cc(C(=O)Nc2ccccc2CCC(C)(C)C)c(C(F)F)n1 |
| InChI | InChI=1S/C18H23F2N3O.C6H8ClN5O2S/c1-18(2,3)10-9-12-7-5-6-8-14(12)21-17(24)13-11-23(4)22-15(13)16(19)20;1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4/h5-8,11,16H,9-10H2,1-4H3,(H,21,24);2H,3H2,1H3,(H2,8,10,11) |
| InChIKey | QBMMELRCZPTYGC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.08 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|