C13H11ClF2N4O2 — CID 141486754
N-[(2-chlorophenyl)carbamoyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide (PubChem CID 141486754) has the molecular formula C13H11ClF2N4O2 and a molecular weight of 328.71 g/mol. Its IUPAC name is N-[(2-chlorophenyl)carbamoyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)carbamoyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 141486754 |
| Molecular Formula | C13H11ClF2N4O2 |
| Molecular Weight | 328.71 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-[(2-chlorophenyl)carbamoyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC(=O)Nc2ccccc2Cl)c(C(F)F)n1 |
| InChI | InChI=1S/C13H11ClF2N4O2/c1-20-6-7(10(19-20)11(15)16)12(21)18-13(22)17-9-5-3-2-4-8(9)14/h2-6,11H,1H3,(H2,17,18,21,22) |
| InChIKey | UYNVETYNACGGNA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |