C19H16F3N3O — CID 68910253
3-(difluoromethyl)-N-[2-[2-(fluoromethyl)phenyl]phenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 68910253) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is 3-(difluoromethyl)-N-[2-[2-(fluoromethyl)phenyl]phenyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-(difluoromethyl)-N-[2-[2-(fluoromethyl)phenyl]phenyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 68910253 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-(difluoromethyl)-N-[2-[2-(fluoromethyl)phenyl]phenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccccc2-c2ccccc2CF)c(C(F)F)n1 |
| InChI | InChI=1S/C19H16F3N3O/c1-25-11-15(17(24-25)18(21)22)19(26)23-16-9-5-4-8-14(16)13-7-3-2-6-12(13)10-20/h2-9,11,18H,10H2,1H3,(H,23,26) |
| InChIKey | GYENZBQJOFOCBC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |