C7H10ClN5O2S — CID 173316069
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-ethyl-2-nitroguanidine (PubChem CID 173316069) has the molecular formula C7H10ClN5O2S and a molecular weight of 263.71 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-ethyl-2-nitroguanidine.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-ethyl-2-nitroguanidine |
|---|---|
| PubChem CID | 173316069 |
| Molecular Formula | C7H10ClN5O2S |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-ethyl-2-nitroguanidine |
| SMILES | CCNC(=N[N+](=O)[O-])NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H10ClN5O2S/c1-2-9-7(12-13(14)15)11-4-5-3-10-6(8)16-5/h3H,2,4H2,1H3,(H2,9,11,12) |
| InChIKey | SYFCSXNYQAXSPC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|