C8H11ClN4O2S — CID 174271105
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N',N'-dimethyl-1-nitroethene-1,2-diamine (PubChem CID 174271105) has the molecular formula C8H11ClN4O2S and a molecular weight of 262.72 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N',N'-dimethyl-1-nitroethene-1,2-diamine.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N',N'-dimethyl-1-nitroethene-1,2-diamine |
|---|---|
| PubChem CID | 174271105 |
| Molecular Formula | C8H11ClN4O2S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N',N'-dimethyl-1-nitroethene-1,2-diamine |
| SMILES | CN(C)C=C(NCc1cnc(Cl)s1)[N+](=O)[O-] |
| InChI | InChI=1S/C8H11ClN4O2S/c1-12(2)5-7(13(14)15)10-3-6-4-11-8(9)16-6/h4-5,10H,3H2,1-2H3 |
| InChIKey | AYRRZBNZJZUTMB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|