C9H13ClN4O2S — CID 141309830
(E)-1-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-N'-ethyl-1-N'-methyl-2-nitroethene-1,1-diamine (PubChem CID 141309830) has the molecular formula C9H13ClN4O2S and a molecular weight of 276.75 g/mol. Its IUPAC name is (E)-1-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-N'-ethyl-1-N'-methyl-2-nitroethene-1,1-diamine.
| Compound Name | (E)-1-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-N'-ethyl-1-N'-methyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 141309830 |
| Molecular Formula | C9H13ClN4O2S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (E)-1-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-N'-ethyl-1-N'-methyl-2-nitroethene-1,1-diamine |
| SMILES | CCN(C)/C(=C/[N+](=O)[O-])NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C9H13ClN4O2S/c1-3-13(2)8(6-14(15)16)11-4-7-5-12-9(10)17-7/h5-6,11H,3-4H2,1-2H3/b8-6+ |
| InChIKey | WBZCWISYHRUXIY-SOFGYWHQSA-N |
| XLogP | 1.91 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|