C11H14Cl4N4O3S — CID 67791191
1,1,1-trichloro-4-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-4-(methylamino)-3-nitrobut-3-en-2-ol (PubChem CID 67791191) has the molecular formula C11H14Cl4N4O3S and a molecular weight of 424.14 g/mol. Its IUPAC name is 1,1,1-trichloro-4-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-4-(methylamino)-3-nitrobut-3-en-2-ol.
| Compound Name | 1,1,1-trichloro-4-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-4-(methylamino)-3-nitrobut-3-en-2-ol |
|---|---|
| PubChem CID | 67791191 |
| Molecular Formula | C11H14Cl4N4O3S |
| Molecular Weight | 424.14 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | 1,1,1-trichloro-4-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-4-(methylamino)-3-nitrobut-3-en-2-ol |
| SMILES | CCN(Cc1cnc(Cl)s1)C(NC)=C(C(O)C(Cl)(Cl)Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C11H14Cl4N4O3S/c1-3-18(5-6-4-17-10(12)23-6)9(16-2)7(19(21)22)8(20)11(13,14)15/h4,8,16,20H,3,5H2,1-2H3 |
| InChIKey | ZMJLLTMNMYFPME-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.14 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|